ethyl 2-chloro-2-[(2-prop-2-enoxyphenyl)hydrazinylidene]acetate structure
|
Common Name | ethyl 2-chloro-2-[(2-prop-2-enoxyphenyl)hydrazinylidene]acetate | ||
|---|---|---|---|---|
| CAS Number | 61364-10-1 | Molecular Weight | 282.72300 | |
| Density | 1.17g/cm3 | Boiling Point | 380.9ºC at 760 mmHg | |
| Molecular Formula | C13H15ClN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 184.2ºC | |
| Name | Acetic acid, chloro[[2-(2-propenyloxy)phenyl]hydrazono]-, ethyl ester |
|---|---|
| Synonym | More Synonyms |
| Density | 1.17g/cm3 |
|---|---|
| Boiling Point | 380.9ºC at 760 mmHg |
| Molecular Formula | C13H15ClN2O3 |
| Molecular Weight | 282.72300 |
| Flash Point | 184.2ºC |
| Exact Mass | 282.07700 |
| PSA | 59.92000 |
| LogP | 2.85170 |
| Index of Refraction | 1.525 |
| InChIKey | YOKPTZVBIVLOOO-UHFFFAOYSA-N |
| SMILES | C=CCOc1ccccc1NN=C(Cl)C(=O)OCC |
|
~%
ethyl 2-chloro-... CAS#:61364-10-1 |
| Literature: Garanti,L. et al. Journal of Organic Chemistry, 1977 , vol. 42, # 8 p. 1389 - 1392 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| Chlornonamethylcyclopentasilan |
| chloro-(2-allyloxy-phenylhydrazono)-acetic acid ethyl ester |
| Cyclopentasilane,chlorononamethyl |