ethyl 3a,4-dihydro-3H-pyrazolo[5,1-c][1,4]benzoxazine-2-carboxylate
![ethyl 3a,4-dihydro-3H-pyrazolo[5,1-c][1,4]benzoxazine-2-carboxylate Structure](https://image.chemsrc.com/caspic/252/61364-13-4.png)
ethyl 3a,4-dihydro-3H-pyrazolo[5,1-c][1,4]benzoxazine-2-carboxylate structure
|
Common Name | ethyl 3a,4-dihydro-3H-pyrazolo[5,1-c][1,4]benzoxazine-2-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 61364-13-4 | Molecular Weight | 246.26200 | |
| Density | 1.35g/cm3 | Boiling Point | 364.2ºC at 760 mmHg | |
| Molecular Formula | C13H14N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 174ºC | |
Summary: ethyl 3a,4-dihydro-3H-pyrazolo[5,1-c][1,4]benzoxazine-2-carboxylate, Chinese name, CAS number 61364-13-4, molecular formula C13H14N2O3, molecular weight 246.26200. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | ethyl 3a,4-dihydro-3H-pyrazolo[5,1-c][1,4]benzoxazine-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.35g/cm3 |
|---|---|
| Boiling Point | 364.2ºC at 760 mmHg |
| Molecular Formula | C13H14N2O3 |
| Molecular Weight | 246.26200 |
| Flash Point | 174ºC |
| Exact Mass | 246.10000 |
| PSA | 51.13000 |
| LogP | 1.07740 |
| Index of Refraction | 1.639 |
| InChIKey | CBUPCRFPMZGTLM-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NN2c3ccccc3OCC2C1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
ethyl 3a,4-dihy... CAS#:61364-13-4 |
| Literature: Garanti,L. et al. Journal of Organic Chemistry, 1977 , vol. 42, # 8 p. 1389 - 1392 |
|
~%
ethyl 3a,4-dihy... CAS#:61364-13-4 |
| Literature: Garanti,L. et al. Journal of Organic Chemistry, 1977 , vol. 42, # 8 p. 1389 - 1392 |
![ethyl 2-chloro-2-[(2-prop-2-enoxyphenyl)hydrazinylidene]acetate structure](https://image.chemsrc.com/caspic/366/61364-10-1.png)
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 3a,4-dihydro-3H-benzo[b]pyrazolo[1,5-d][1,4]oxazine-2-carboxylic acid ethyl ester |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the upstream materials of ethyl 3a,4-dihydro-3H-pyrazolo[5,1-c][1,4]benzoxazine-2-carboxylate? |
| A: Related upstream materials(CAS) of ethyl 3a,4-dihydro-3H-pyrazolo[5,1-c][1,4]benzoxazine-2-carboxylate: 61364-10-1;27096-64-6. |
| Q: What is the LogP of ethyl 3a,4-dihydro-3H-pyrazolo[5,1-c][1,4]benzoxazine-2-carboxylate? |
| A: LogP of ethyl 3a,4-dihydro-3H-pyrazolo[5,1-c][1,4]benzoxazine-2-carboxylate is 1.07740. |
| Q: What is the SMILES notation of ethyl 3a,4-dihydro-3H-pyrazolo[5,1-c][1,4]benzoxazine-2-carboxylate? |
| A: SMILES notation of ethyl 3a,4-dihydro-3H-pyrazolo[5,1-c][1,4]benzoxazine-2-carboxylate is CCOC(=O)C1=NN2c3ccccc3OCC2C1. |
| Q: What is the InChIKey of ethyl 3a,4-dihydro-3H-pyrazolo[5,1-c][1,4]benzoxazine-2-carboxylate? |
| A: InChIKey of ethyl 3a,4-dihydro-3H-pyrazolo[5,1-c][1,4]benzoxazine-2-carboxylate is CBUPCRFPMZGTLM-UHFFFAOYSA-N. |
| Q: What is the molecular formula of ethyl 3a,4-dihydro-3H-pyrazolo[5,1-c][1,4]benzoxazine-2-carboxylate? |
| A: Molecular formula of ethyl 3a,4-dihydro-3H-pyrazolo[5,1-c][1,4]benzoxazine-2-carboxylate is C13H14N2O3. |
| Q: What is the English name of ethyl 3a,4-dihydro-3H-pyrazolo[5,1-c][1,4]benzoxazine-2-carboxylate? |
| A: The English name of ethyl 3a,4-dihydro-3H-pyrazolo[5,1-c][1,4]benzoxazine-2-carboxylate is ethyl 3a,4-dihydro-3H-pyrazolo[5,1-c][1,4]benzoxazine-2-carboxylate. |
| Q: What is the boiling point of ethyl 3a,4-dihydro-3H-pyrazolo[5,1-c][1,4]benzoxazine-2-carboxylate? |
| A: Boiling point of ethyl 3a,4-dihydro-3H-pyrazolo[5,1-c][1,4]benzoxazine-2-carboxylate is 364.2ºC at 760 mmHg. |
| Q: What is the molecular weight of ethyl 3a,4-dihydro-3H-pyrazolo[5,1-c][1,4]benzoxazine-2-carboxylate? |
| A: Molecular weight of ethyl 3a,4-dihydro-3H-pyrazolo[5,1-c][1,4]benzoxazine-2-carboxylate is 246.26200. |
| Q: What English synonyms does ethyl 3a,4-dihydro-3H-pyrazolo[5,1-c][1,4]benzoxazine-2-carboxylate have? |
| A: English synonyms of ethyl 3a,4-dihydro-3H-pyrazolo[5,1-c][1,4]benzoxazine-2-carboxylate: 3a,4-dihydro-3H-benzo[b]pyrazolo[1,5-d][1,4]oxazine-2-carboxylic acid ethyl ester. |
| Q: What is the Chinese name of 61364-13-4? |
| A: Chinese name of 61364-13-4 is 61364-13-4. |