Ethyl 6-chloro-3-hydroxypyridazine-4-carboxylate structure
|
Common Name | Ethyl 6-chloro-3-hydroxypyridazine-4-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 61404-41-9 | Molecular Weight | 202.595 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 364.0±37.0 °C at 760 mmHg | |
| Molecular Formula | C7H7ClN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 173.9±26.5 °C | |
| Name | Ethyl 6-chloro-3-hydroxypyridazine-4-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 364.0±37.0 °C at 760 mmHg |
| Molecular Formula | C7H7ClN2O3 |
| Molecular Weight | 202.595 |
| Flash Point | 173.9±26.5 °C |
| Exact Mass | 202.014526 |
| PSA | 72.31000 |
| LogP | 2.66 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.562 |
| InChIKey | WTBUDFWPROPPOW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cc(Cl)n[nH]c1=O |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933990090 |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| ethyl 3-chloro-6-oxo-1H-pyridazine-5-carboxylate |
| 4-Pyridazinecarboxylic acid, 6-chloro-3-hydroxy-, ethyl ester |
| Ethyl 6-chloro-3-hydroxy-4-pyridazinecarboxylate |