2-(2-morpholin-4-yl-2-oxoethyl)benzoic acid structure
|
Common Name | 2-(2-morpholin-4-yl-2-oxoethyl)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 61418-24-4 | Molecular Weight | 249.26200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H15NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(2-morpholin-4-yl-2-oxoethyl)benzoic acid |
|---|
| Molecular Formula | C13H15NO4 |
|---|---|
| Molecular Weight | 249.26200 |
| Exact Mass | 249.10000 |
| PSA | 66.84000 |
| LogP | 0.72400 |
| InChIKey | PNHWKTFCINKOCC-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccccc1CC(=O)N1CCOCC1 |
|
~%
2-(2-morpholin-... CAS#:61418-24-4 |
| Literature: Boyd,G.V.; Monteil,R.L. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1978 , p. 1338 - 1350 |
|
~%
2-(2-morpholin-... CAS#:61418-24-4 |
| Literature: Boyd,G.V.; Monteil,R.L. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1978 , p. 1338 - 1350 |