6-hydroxy-2-(3-hydroxyphenyl)-2,3-dihydrochromen-4-one structure
|
Common Name | 6-hydroxy-2-(3-hydroxyphenyl)-2,3-dihydrochromen-4-one | ||
|---|---|---|---|---|
| CAS Number | 61429-74-1 | Molecular Weight | 256.25300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H12O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-hydroxy-2-(3-hydroxyphenyl)-2,3-dihydrochromen-4-one |
|---|
| Molecular Formula | C15H12O4 |
|---|---|
| Molecular Weight | 256.25300 |
| Exact Mass | 256.07400 |
| PSA | 66.76000 |
| LogP | 2.80430 |
| InChIKey | FTDCCBIDVVGONG-UHFFFAOYSA-N |
| SMILES | O=C1CC(c2cccc(O)c2)Oc2ccc(O)cc21 |
|
~%
6-hydroxy-2-(3-... CAS#:61429-74-1 |
| Literature: Vyas; Shah Journal of the Indian Chemical Society, 1949 , vol. 26, p. 273,274 |