4-(3-methyl-1,2-oxazol-5-yl)-1,3-diphenylbutan-1-one structure
|
Common Name | 4-(3-methyl-1,2-oxazol-5-yl)-1,3-diphenylbutan-1-one | ||
|---|---|---|---|---|
| CAS Number | 61449-06-7 | Molecular Weight | 305.37000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H19NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(3-methyl-1,2-oxazol-5-yl)-1,3-diphenylbutan-1-one |
|---|
| Molecular Formula | C20H19NO2 |
|---|---|
| Molecular Weight | 305.37000 |
| Exact Mass | 305.14200 |
| PSA | 43.10000 |
| LogP | 4.58230 |
| InChIKey | RWRXUIZTDFKPBO-UHFFFAOYSA-N |
| SMILES | Cc1cc(CC(CC(=O)c2ccccc2)c2ccccc2)on1 |
|
~%
4-(3-methyl-1,2... CAS#:61449-06-7 |
| Literature: Kashima,C. et al. Bulletin of the Chemical Society of Japan, 1976 , vol. 49, p. 2254 - 2258 |