trimethoxy(3-phenoxypropyl)silane structure
|
Common Name | trimethoxy(3-phenoxypropyl)silane | ||
|---|---|---|---|---|
| CAS Number | 61464-03-7 | Molecular Weight | 256.37000 | |
| Density | 1.022g/cm3 | Boiling Point | 285.6ºC at 760 mmHg | |
| Molecular Formula | C12H20O4Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 100.7ºC | |
| Name | trimethoxy(3-phenoxypropyl)silane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.022g/cm3 |
|---|---|
| Boiling Point | 285.6ºC at 760 mmHg |
| Molecular Formula | C12H20O4Si |
| Molecular Weight | 256.37000 |
| Flash Point | 100.7ºC |
| Exact Mass | 256.11300 |
| PSA | 36.92000 |
| LogP | 2.33360 |
| Index of Refraction | 1.47 |
| InChIKey | VUHPZDVFOAYSLG-UHFFFAOYSA-N |
| SMILES | CO[Si](CCCOc1ccccc1)(OC)OC |
| HS Code | 2931900090 |
|---|
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| einecs 262-803-4 |