Chloro(dimethyl)(3-phenoxypropyl)silane
Chloro(dimethyl)(3-phenoxypropyl)silane structure
|
Common Name | Chloro(dimethyl)(3-phenoxypropyl)silane | ||
|---|---|---|---|---|
| CAS Number | 69733-73-9 | Molecular Weight | 228.791 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 290.4±23.0 °C at 760 mmHg | |
| Molecular Formula | C11H17ClOSi | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 108.2±14.7 °C | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | chloro-dimethyl-(3-phenoxypropyl)silane |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 290.4±23.0 °C at 760 mmHg |
| Molecular Formula | C11H17ClOSi |
| Molecular Weight | 228.791 |
| Flash Point | 108.2±14.7 °C |
| Exact Mass | 228.073715 |
| PSA | 9.23000 |
| LogP | 4.42 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.486 |
| InChIKey | CDZQZJKHGHWQJC-UHFFFAOYSA-N |
| SMILES | C[Si](C)(Cl)CCCOc1ccccc1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | C |
|---|---|
| Risk Phrases | 34 |
| Safety Phrases | 26-36/37/39 |
| RIDADR | UN 2987 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~68%
Chloro(dimethyl... CAS#:69733-73-9 |
| Literature: Chernyshev; Belyakova; Sheludyakov; Shevchenko Russian Chemical Bulletin, 1997 , vol. 46, # 5 p. 1003 - 1006 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Chlordimethyl-(3-phenoxy)propylsilan |
| Chlorodimethyl(3-phenoxypropyl)silane |
| 3-PHENOXYPROPYLDIMETHYLCHLOROSILANE |
| Chloro(dimethyl)(3-phenoxypropyl)silane |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the boiling point of chloro-dimethyl-(3-phenoxypropyl)silane? |
| A: Boiling point of chloro-dimethyl-(3-phenoxypropyl)silane is 290.4±23.0 °C at 760 mmHg. |
| Q: What is the LogP of chloro-dimethyl-(3-phenoxypropyl)silane? |
| A: LogP of chloro-dimethyl-(3-phenoxypropyl)silane is 4.42. |
| Q: What is the molecular weight of chloro-dimethyl-(3-phenoxypropyl)silane? |
| A: Molecular weight of chloro-dimethyl-(3-phenoxypropyl)silane is 228.791. |
| Q: What English synonyms does chloro-dimethyl-(3-phenoxypropyl)silane have? |
| A: English synonyms of chloro-dimethyl-(3-phenoxypropyl)silane: Chlordimethyl-(3-phenoxy)propylsilan, Chlorodimethyl(3-phenoxypropyl)silane, 3-PHENOXYPROPYLDIMETHYLCHLOROSILANE, Chloro(dimethyl)(3-phenoxypropyl)silane. |
| Q: What is the polar surface area (PSA) of chloro-dimethyl-(3-phenoxypropyl)silane? |
| A: Polar surface area (PSA) of chloro-dimethyl-(3-phenoxypropyl)silane is 9.23000. |
| Q: What is the safety information for chloro-dimethyl-(3-phenoxypropyl)silane? |
| A: Safety information for chloro-dimethyl-(3-phenoxypropyl)silane: 26-36/37/39. |
| Q: What is the InChIKey of chloro-dimethyl-(3-phenoxypropyl)silane? |
| A: InChIKey of chloro-dimethyl-(3-phenoxypropyl)silane is CDZQZJKHGHWQJC-UHFFFAOYSA-N. |
| Q: What is the CAS number of chloro-dimethyl-(3-phenoxypropyl)silane? |
| A: CAS number of chloro-dimethyl-(3-phenoxypropyl)silane is 69733-73-9. |
| Q: What is the molecular formula of chloro-dimethyl-(3-phenoxypropyl)silane? |
| A: Molecular formula of chloro-dimethyl-(3-phenoxypropyl)silane is C11H17ClOSi. |
| Q: What is the SMILES notation of chloro-dimethyl-(3-phenoxypropyl)silane? |
| A: SMILES notation of chloro-dimethyl-(3-phenoxypropyl)silane is C[Si](C)(Cl)CCCOc1ccccc1. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |