1-Boc-4-Fluoro-4-(hydroxymethyl)piperidine structure
|
Common Name | 1-Boc-4-Fluoro-4-(hydroxymethyl)piperidine | ||
|---|---|---|---|---|
| CAS Number | 614730-97-1 | Molecular Weight | 233.280 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 311.0±27.0 °C at 760 mmHg | |
| Molecular Formula | C11H20FNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 141.9±23.7 °C | |
| Name | 1-Boc-4-Fluoro-4-(hydroxymethyl)piperidine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 311.0±27.0 °C at 760 mmHg |
| Molecular Formula | C11H20FNO3 |
| Molecular Weight | 233.280 |
| Flash Point | 141.9±23.7 °C |
| Exact Mass | 233.142715 |
| PSA | 49.77000 |
| LogP | 0.86 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.481 |
| InChIKey | BWZOULIMVKCGII-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(F)(CO)CC1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933399090 |
|
~67%
1-Boc-4-Fluoro-... CAS#:614730-97-1 |
| Literature: AC Immune S.A. Patent: EP2377860 A1, 2011 ; Location in patent: Page/Page column 26 ; |
|
~67%
1-Boc-4-Fluoro-... CAS#:614730-97-1 |
| Literature: CANCER RESEARCH TECHNOLOGY LIMITED Patent: WO2009/44162 A1, 2009 ; Location in patent: Page/Page column 247 ; WO 2009/044162 A1 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| tert-butyl 4-fluoro-4-(hydroxymethyl)piperidine-1-carboxylate |