S-(+)-HEXAHYDROMANDELIC ACID
S-(+)-HEXAHYDROMANDELIC ACID structure
|
Common Name | S-(+)-HEXAHYDROMANDELIC ACID | ||
|---|---|---|---|---|
| CAS Number | 61475-31-8 | Molecular Weight | 158.19500 | |
| Density | 1.178g/cm3 | Boiling Point | 319.3ºC at 760 mmHg | |
| Molecular Formula | C8H14O3 | Melting Point | 127-130ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 161.1ºC | |
Summary: (S)-alpha-hydroxyhexahydropinaneacetic acid, also known as (S)-2-cyclohexyl-2-hydroxyethanoic acid, is named (s)-(+)-hexahydromandelic acid. Its CAS number is 61475-31-8, with a molecular formula of C8H14O3 and a molecular weight of 158.19500. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (s)-(+)-hexahydromandelic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.178g/cm3 |
|---|---|
| Boiling Point | 319.3ºC at 760 mmHg |
| Melting Point | 127-130ºC(lit.) |
| Molecular Formula | C8H14O3 |
| Molecular Weight | 158.19500 |
| Flash Point | 161.1ºC |
| Exact Mass | 158.09400 |
| PSA | 57.53000 |
| LogP | 1.01220 |
| Index of Refraction | 1.508 |
| InChIKey | RRDPWAPIJGSANI-ZETCQYMHSA-N |
| SMILES | C1CCC(CC1)[C@@H](C(=O)O)O |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xi |
| Safety Phrases | 22-24/25 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2918199090 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 7 | |
|---|---|
| DownStream 0 | |
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2918199090 |
|---|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| MFCD00057821 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of (s)-(+)-hexahydromandelic acid? |
| A: Polar surface area (PSA) of (s)-(+)-hexahydromandelic acid is 57.53000. |
| Q: What is the molecular weight of (s)-(+)-hexahydromandelic acid? |
| A: Molecular weight of (s)-(+)-hexahydromandelic acid is 158.19500. |
| Q: What is the English name of (s)-(+)-hexahydromandelic acid? |
| A: The English name of (s)-(+)-hexahydromandelic acid is (s)-(+)-hexahydromandelic acid. |
| Q: What is the melting point of (s)-(+)-hexahydromandelic acid? |
| A: Melting point of (s)-(+)-hexahydromandelic acid is 127-130ºC(lit.). |
| Q: What is the safety information for (s)-(+)-hexahydromandelic acid? |
| A: Safety information for (s)-(+)-hexahydromandelic acid: 22-24/25. |
| Q: What is the InChIKey of (s)-(+)-hexahydromandelic acid? |
| A: InChIKey of (s)-(+)-hexahydromandelic acid is RRDPWAPIJGSANI-ZETCQYMHSA-N. |
| Q: What are the upstream materials of (s)-(+)-hexahydromandelic acid? |
| A: Related upstream materials(CAS) of (s)-(+)-hexahydromandelic acid: 17199-29-0;4354-49-8;7560-69-2;108104-21-8;105880-38-4;2043-61-0;108104-23-0. |
| Q: What English synonyms does (s)-(+)-hexahydromandelic acid have? |
| A: English synonyms of (s)-(+)-hexahydromandelic acid: MFCD00057821. |
| Q: What is the boiling point of (s)-(+)-hexahydromandelic acid? |
| A: Boiling point of (s)-(+)-hexahydromandelic acid is 319.3ºC at 760 mmHg. |
| Q: What is the LogP of (s)-(+)-hexahydromandelic acid? |
| A: LogP of (s)-(+)-hexahydromandelic acid is 1.01220. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |