N-benzyl-N-(3-methylpent-3-enyl)acetamide structure
|
Common Name | N-benzyl-N-(3-methylpent-3-enyl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 61481-99-0 | Molecular Weight | 231.33300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H21NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-benzyl-N-(3-methylpent-3-enyl)acetamide |
|---|
| Molecular Formula | C15H21NO |
|---|---|
| Molecular Weight | 231.33300 |
| Exact Mass | 231.16200 |
| PSA | 20.31000 |
| LogP | 3.39140 |
| InChIKey | MMUYIXSIPFYZHD-UHFFFAOYSA-N |
| SMILES | CC=C(C)CCN(Cc1ccccc1)C(C)=O |
|
~%
N-benzyl-N-(3-m... CAS#:61481-99-0 |
| Literature: Mori,M.; Ban,Y. Chemical and Pharmaceutical Bulletin, 1976 , vol. 24, p. 1992 - 1999 |
|
~%
N-benzyl-N-(3-m... CAS#:61481-99-0 |
| Literature: Mori,M.; Ban,Y. Chemical and Pharmaceutical Bulletin, 1976 , vol. 24, p. 1992 - 1999 |