Ethyl(triphenyl)phosphonium bromide structure
|
Common Name | Ethyl(triphenyl)phosphonium bromide | ||
|---|---|---|---|---|
| CAS Number | 1530-32-1 | Molecular Weight | 371.251 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H20BrP | Melting Point | 203-205 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 200 °C | |
| Symbol |
GHS06, GHS09 |
Signal Word | Danger | |
| Name | Ethyltriphenylphosphonium bromide |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 203-205 °C(lit.) |
|---|---|
| Molecular Formula | C20H20BrP |
| Molecular Weight | 371.251 |
| Flash Point | 200 °C |
| Exact Mass | 370.048584 |
| PSA | 13.59000 |
| LogP | 1.00440 |
| InChIKey | JHYNXXDQQHTCHJ-UHFFFAOYSA-M |
| SMILES | CC[P+](c1ccccc1)(c1ccccc1)c1ccccc1.[Br-] |
| Water Solubility | 120 g/L (23 ºC) |
| Symbol |
GHS06, GHS09 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301-H411 |
| Precautionary Statements | P273-P301 + P310 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
| Hazard Codes | Xn:Harmful |
| Risk Phrases | R21/22;R36/37/38;R51/53 |
| Safety Phrases | S61-S36/37/39-S26 |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 2 |
| Packaging Group | III |
| Hazard Class | 6.1 |
| HS Code | 29310095 |
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| UNII-R85V84UL5V |
| ethyltriphenyl phosphonium bromide |
| Ethyltriphenylphosphonium bromide |
| ethyltriphenyl-phosphonium bromide |
| triphenylethylphosphonium bromide |
| Phosphonium, ethyltriphenyl-, bromide (1:1) |
| (Ethyl)-triphenylphosphonium bromide |
| EINECS 216-223-3 |
| phosphonium, ethyltriphenyl-, bromide |
| ethyl(triphenyl)phosphanium,bromide |
| Ethyl triphenylphosphonium Bromide |
| MFCD00011838 |
| Ethyl triphenyl phosphonium bromide |