7-chloro-6-methoxy-2-(4-methoxyphenyl)quinoline structure
|
Common Name | 7-chloro-6-methoxy-2-(4-methoxyphenyl)quinoline | ||
|---|---|---|---|---|
| CAS Number | 61576-11-2 | Molecular Weight | 299.75200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H14ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 7-chloro-6-methoxy-2-(4-methoxyphenyl)quinoline |
|---|
| Molecular Formula | C17H14ClNO2 |
|---|---|
| Molecular Weight | 299.75200 |
| Exact Mass | 299.07100 |
| PSA | 31.35000 |
| LogP | 4.57240 |
| InChIKey | NCVIDKMRAUHQAT-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2ccc3cc(OC)c(Cl)cc3n2)cc1 |
|
~97%
7-chloro-6-meth... CAS#:61576-11-2 |
| Literature: Epling, Gary A.; Lin, Kuei-Ying; Kumar, Anil Journal of Heterocyclic Chemistry, 1988 , vol. 25, p. 425 - 429 |
|
~99%
7-chloro-6-meth... CAS#:61576-11-2 |
| Literature: Epling, Gary A.; Lin, Kuei-Ying; Kumar, Anil Journal of Heterocyclic Chemistry, 1988 , vol. 25, p. 425 - 429 |