7-chloro-2-(4-methoxyphenyl)quinoline-4-carboxylic acid structure
|
Common Name | 7-chloro-2-(4-methoxyphenyl)quinoline-4-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 6338-24-5 | Molecular Weight | 313.73500 | |
| Density | 1.36g/cm3 | Boiling Point | 513.1ºC at 760 mmHg | |
| Molecular Formula | C17H12ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 264.1ºC | |
| Name | 7-chloro-2-(4-methoxyphenyl)quinoline-4-carboxylic acid |
|---|
| Density | 1.36g/cm3 |
|---|---|
| Boiling Point | 513.1ºC at 760 mmHg |
| Molecular Formula | C17H12ClNO3 |
| Molecular Weight | 313.73500 |
| Flash Point | 264.1ºC |
| Exact Mass | 313.05100 |
| PSA | 59.42000 |
| LogP | 4.26200 |
| Index of Refraction | 1.661 |
| InChIKey | SWAZLUGHVFRSEA-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2cc(C(=O)O)c3ccc(Cl)cc3n2)cc1 |
|
~%
7-chloro-2-(4-m... CAS#:6338-24-5 |
| Literature: Lutz et al. Journal of the American Chemical Society, 1946 , vol. 68, p. 1810 |
|
~%
7-chloro-2-(4-m... CAS#:6338-24-5
Detail
|
| Literature: Lutz et al. Journal of the American Chemical Society, 1946 , vol. 68, p. 1810 |