2,4-Di-tert-butyl-6-methylphenol structure
|
Common Name | 2,4-Di-tert-butyl-6-methylphenol | ||
|---|---|---|---|---|
| CAS Number | 616-55-7 | Molecular Weight | 220.350 | |
| Density | 0.9±0.1 g/cm3 | Boiling Point | 269.0±0.0 °C at 760 mmHg | |
| Molecular Formula | C15H24O | Melting Point | 50-52ºC | |
| MSDS | N/A | Flash Point | 123.0±8.4 °C | |
| Name | 2,4-ditert-butyl-6-methylphenol |
|---|---|
| Synonym | More Synonyms |
| Density | 0.9±0.1 g/cm3 |
|---|---|
| Boiling Point | 269.0±0.0 °C at 760 mmHg |
| Melting Point | 50-52ºC |
| Molecular Formula | C15H24O |
| Molecular Weight | 220.350 |
| Flash Point | 123.0±8.4 °C |
| Exact Mass | 220.182709 |
| PSA | 20.23000 |
| LogP | 5.32 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.499 |
| InChIKey | ZZZRZBIPCKQDQR-UHFFFAOYSA-N |
| SMILES | Cc1cc(C(C)(C)C)cc(C(C)(C)C)c1O |
| Hazard Codes | Xi |
|---|
| Precursor 10 | |
|---|---|
| DownStream 4 | |
|
Name: Partition coefficient, log K of the compound in n-hexane/methyl tert-butylether/aceto...
Source: ChEMBL
Target: N/A
External Id: CHEMBL3123995
|
| 4,6-DI-TERT-BUTYL-2-METHYLPHENOL |
| 4,6-di-tert-butyl-o-cresol |
| 2,4-Di-tert-butyl-6-methylphenol |
| 2-Methyl-4,6-bis(2-methyl-2-propanyl)phenol |
| 2-Hydroxy-1-methyl-3.5-di-tert.-butyl-benzol |
| 2-methyl-4,6-di-t-butylphenol |