2,4-Di-tert-butyl-6-methylphenol
2,4-Di-tert-butyl-6-methylphenol structure
|
Common Name | 2,4-Di-tert-butyl-6-methylphenol | ||
|---|---|---|---|---|
| CAS Number | 616-55-7 | Molecular Weight | 220.350 | |
| Density | 0.9±0.1 g/cm3 | Boiling Point | 269.0±0.0 °C at 760 mmHg | |
| Molecular Formula | C15H24O | Melting Point | 50-52ºC | |
| MSDS | N/A | Flash Point | 123.0±8.4 °C | |
Summary: 2,4-ditert-butyl-6-methylphenol, Chinese name: 2,4-二(1,1-二甲乙基)-6-甲酚, CAS number: 616-55-7, molecular formula: C15H24O, molecular weight: 220.350. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,4-ditert-butyl-6-methylphenol |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 0.9±0.1 g/cm3 |
|---|---|
| Boiling Point | 269.0±0.0 °C at 760 mmHg |
| Melting Point | 50-52ºC |
| Molecular Formula | C15H24O |
| Molecular Weight | 220.350 |
| Flash Point | 123.0±8.4 °C |
| Exact Mass | 220.182709 |
| PSA | 20.23000 |
| LogP | 5.32 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.499 |
| InChIKey | ZZZRZBIPCKQDQR-UHFFFAOYSA-N |
| SMILES | Cc1cc(C(C)(C)C)cc(C(C)(C)C)c1O |
This table provides MSDS information including hazard classification, first‑aid, fire‑fighting, spill handling, operation and storage instructions.
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | Xi |
|---|
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 10 | |
|---|---|
| DownStream 4 | |
CAS#:95-48-7
CAS#:115-11-7
CAS#:917-92-0
CAS#:16373-02-7
CAS#:507-20-0
CAS#:2219-82-1
CAS#:507-19-7
CAS#:51067-62-0
CAS#:128-37-0
CAS#:108715-85-1
CAS#:110472-19-0
CAS#:37942-07-7
CAS#:98-27-1This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Partition coefficient, log K of the compound in n-hexane/methyl tert-butylether/aceto...
Source: ChEMBL
Target: N/A
External Id: CHEMBL3123995
|
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4,6-DI-TERT-BUTYL-2-METHYLPHENOL |
| 4,6-di-tert-butyl-o-cresol |
| 2,4-Di-tert-butyl-6-methylphenol |
| 2-Methyl-4,6-bis(2-methyl-2-propanyl)phenol |
| 2-Hydroxy-1-methyl-3.5-di-tert.-butyl-benzol |
| 2-methyl-4,6-di-t-butylphenol |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 2,4-ditert-butyl-6-methylphenol? |
| A: CAS number of 2,4-ditert-butyl-6-methylphenol is 616-55-7. |
| Q: What is the molecular formula of 2,4-ditert-butyl-6-methylphenol? |
| A: Molecular formula of 2,4-ditert-butyl-6-methylphenol is C15H24O. |
| Q: What are the downstream products of 2,4-ditert-butyl-6-methylphenol? |
| A: Related downstream products(CAS) of 2,4-ditert-butyl-6-methylphenol: 110472-19-0;37942-07-7;98-27-1;2219-82-1. |
| Q: What is the polar surface area (PSA) of 2,4-ditert-butyl-6-methylphenol? |
| A: Polar surface area (PSA) of 2,4-ditert-butyl-6-methylphenol is 20.23000. |
| Q: What is the LogP of 2,4-ditert-butyl-6-methylphenol? |
| A: LogP of 2,4-ditert-butyl-6-methylphenol is 5.32. |
| Q: What is the InChIKey of 2,4-ditert-butyl-6-methylphenol? |
| A: InChIKey of 2,4-ditert-butyl-6-methylphenol is ZZZRZBIPCKQDQR-UHFFFAOYSA-N. |
| Q: What is the boiling point of 2,4-ditert-butyl-6-methylphenol? |
| A: Boiling point of 2,4-ditert-butyl-6-methylphenol is 269.0±0.0 °C at 760 mmHg. |
| Q: What is the molecular weight of 2,4-ditert-butyl-6-methylphenol? |
| A: Molecular weight of 2,4-ditert-butyl-6-methylphenol is 220.350. |
| Q: What are the upstream materials of 2,4-ditert-butyl-6-methylphenol? |
| A: Related upstream materials(CAS) of 2,4-ditert-butyl-6-methylphenol: 95-48-7;115-11-7;917-92-0;16373-02-7;507-20-0;2219-82-1;507-19-7;51067-62-0;128-37-0;108715-85-1. |
| Q: What is the English name of 2,4-ditert-butyl-6-methylphenol? |
| A: The English name of 2,4-ditert-butyl-6-methylphenol is 2,4-ditert-butyl-6-methylphenol. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |