benzamidomethyl benzoate structure
|
Common Name | benzamidomethyl benzoate | ||
|---|---|---|---|---|
| CAS Number | 61652-83-3 | Molecular Weight | 255.26900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H13NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | benzamidomethyl benzoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H13NO3 |
|---|---|
| Molecular Weight | 255.26900 |
| Exact Mass | 255.09000 |
| PSA | 58.89000 |
| LogP | 2.80570 |
| InChIKey | SGHPVLURSRKPOW-UHFFFAOYSA-N |
| SMILES | O=C(NCOC(=O)c1ccccc1)c1ccccc1 |
|
~71%
benzamidomethyl... CAS#:61652-83-3 |
| Literature: Popovski, Emil; Klisarova, Ljiljana; Vikic-Topic, Drazen Molecules, 2000 , vol. 5, # 7 p. 927 - 936 |
|
~%
benzamidomethyl... CAS#:61652-83-3 |
| Literature: Iley, Jim; Moreira, Rui; Rosa, Eduarda Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1991 , # 5 p. 563 - 570 |
| N-Benzoyloxymethyl-benzamid |