1H-Indole,5-methoxy-3-(2-nitroethenyl)- structure
|
Common Name | 1H-Indole,5-methoxy-3-(2-nitroethenyl)- | ||
|---|---|---|---|---|
| CAS Number | 61675-19-2 | Molecular Weight | 218.20900 | |
| Density | 1.337g/cm3 | Boiling Point | 438.5ºC at 760mmHg | |
| Molecular Formula | C11H10N2O3 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 219ºC | |
| Name | 5-methoxy-3-(2-nitrovinyl)-indol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.337g/cm3 |
|---|---|
| Boiling Point | 438.5ºC at 760mmHg |
| Molecular Formula | C11H10N2O3 |
| Molecular Weight | 218.20900 |
| Flash Point | 219ºC |
| Exact Mass | 218.06900 |
| PSA | 70.84000 |
| LogP | 2.94710 |
| Index of Refraction | 1.691 |
| InChIKey | NAIAZIKEFZGLDL-SNAWJCMRSA-N |
| SMILES | COc1ccc2[nH]cc(C=C[N+](=O)[O-])c2c1 |
| RIDADR | NONH for all modes of transport |
|---|---|
| HS Code | 2933990090 |
|
~94%
1H-Indole,5-met... CAS#:61675-19-2 |
| Literature: Zhang, Pu Yong; Wan, Sheng Biao; Ren, Su Mei; Jiang, Tao Chinese Chemical Letters, 2010 , vol. 21, # 11 p. 1307 - 1309 |
|
~%
1H-Indole,5-met... CAS#:61675-19-2 |
| Literature: Archiv der Pharmazie, , vol. 338, # 2-3 p. 67 - 73 |
| Precursor 3 | |
|---|---|
| DownStream 6 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-methoxy-3-(2-nitro-vinyl)-indole |
| 5-methoxy-3-(2'-nitroethenyl)indole |
| 3-(2-Nitro-vinyl)-5-methoxy-indol |
| 5-METHOXYINDOLE-3-NITRO VINYL |
| 5-methoxy-3-[2-nitroethenyl]-1H-indole |