4-ethoxy-N-methyl-2-nitroaniline structure
|
Common Name | 4-ethoxy-N-methyl-2-nitroaniline | ||
|---|---|---|---|---|
| CAS Number | 61679-18-3 | Molecular Weight | 196.20300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H12N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-ethoxy-N-methyl-2-nitroaniline |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H12N2O3 |
|---|---|
| Molecular Weight | 196.20300 |
| Exact Mass | 196.08500 |
| PSA | 67.08000 |
| LogP | 2.63140 |
| InChIKey | DTJXSLYJMZSTII-UHFFFAOYSA-N |
| SMILES | CCOc1ccc(NC)c([N+](=O)[O-])c1 |
|
~0%
4-ethoxy-N-meth... CAS#:61679-18-3 |
| Literature: Baum, Marc M.; Smith, Edward H. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1993 , # 21 p. 2513 - 2520 |
|
~%
4-ethoxy-N-meth... CAS#:61679-18-3 |
| Literature: Friedrich; Bernhauer Chemische Berichte, 1956 , vol. 89, p. 2030,2038 |
|
~%
4-ethoxy-N-meth... CAS#:61679-18-3 |
| Literature: Friedrich; Bernhauer Chemische Berichte, 1956 , vol. 89, p. 2030,2038 |
|
~%
4-ethoxy-N-meth... CAS#:61679-18-3 |
| Literature: Friedrich; Bernhauer Chemische Berichte, 1956 , vol. 89, p. 2030,2038 |
| Benzenamine,4-ethoxy-N-methyl-2-nitro |
| 4-Methoxy-2-nitro-N-methylaniline |
| 4-Aethoxy-N-methyl-2-nitro-anilin |
| 4-ethoxy-N-methyl-2-nitro-aniline |
| 2-Nitro-4-ethoxy-N-methyl-anilin |