Benzenamine,4-ethoxy-2-nitro structure
|
Common Name | Benzenamine,4-ethoxy-2-nitro | ||
|---|---|---|---|---|
| CAS Number | 616-86-4 | Molecular Weight | 182.17700 | |
| Density | 1.264 g/cm3 | Boiling Point | 346.2ºC at 760 mmHg | |
| Molecular Formula | C8H10N2O3 | Melting Point | 111-113 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 163.2ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 4-ethoxy-2-nitroaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.264 g/cm3 |
|---|---|
| Boiling Point | 346.2ºC at 760 mmHg |
| Melting Point | 111-113 °C(lit.) |
| Molecular Formula | C8H10N2O3 |
| Molecular Weight | 182.17700 |
| Flash Point | 163.2ºC |
| Exact Mass | 182.06900 |
| PSA | 81.07000 |
| LogP | 2.68010 |
| Index of Refraction | 1.585 |
| InChIKey | ISFYBUAVOZFROB-UHFFFAOYSA-N |
| SMILES | CCOc1ccc(N)c([N+](=O)[O-])c1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302 + H312 + H332-H315-H319-H335 |
| Precautionary Statements | P261-P280-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn: Harmful; |
| Risk Phrases | R20/21/22 |
| Safety Phrases | S26-S37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2922299090 |
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Assay for both ascorbic and dehydroascorbic acid in dairy foods by high-performance liquid chromatography using precolumn derivatization with methoxy- and ethoxy-1,2-phenylenediamine.
J. Chromatogr. A. 543(2) , 367-74, (1991) A procedure for the simultaneous determination of both ascorbic and dehydroascorbic acid in dairy foods by high-performance liquid chromatography using precolumn derivatization with 4-methoxy- and 4-e... |
| EINECS 210-497-8 |
| 4-Aethoxy-2-nitro-anilin |
| p-Phenetidine,2-nitro |
| 4-Amino-3-nitrophenetole |
| 2-nitro-4-ethoxy-aniline |
| 3-nitro-4-amino-phenetole |
| 2-Nitro-p-phenetidin |
| Benzenamine,4-ethoxy-2-nitro |
| 2-Nitro-p-phenetidine |
| MFCD00007153 |
| 4-ethoxy-2-nitro-aniline |