2-[5,5-Dimethyl-4-(1-methylethyl)-1,3-dioxan-2-yl]phenol structure
|
Common Name | 2-[5,5-Dimethyl-4-(1-methylethyl)-1,3-dioxan-2-yl]phenol | ||
|---|---|---|---|---|
| CAS Number | 61683-82-7 | Molecular Weight | 250.33 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H22O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-[5,5-Dimethyl-4-(1-methylethyl)-1,3-dioxan-2-yl]phenol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H22O3 |
|---|---|
| Molecular Weight | 250.33 |
| InChIKey | KOQWMNGJIQKXIZ-UHFFFAOYSA-N |
| SMILES | CC(C)C1OC(c2ccccc2O)OCC1(C)C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 2-[5,5-Dimethyl-4-(1-methylethyl)-1,3-dioxan-2-yl]phenol? |
| A: InChIKey of 2-[5,5-Dimethyl-4-(1-methylethyl)-1,3-dioxan-2-yl]phenol is KOQWMNGJIQKXIZ-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 2-[5,5-Dimethyl-4-(1-methylethyl)-1,3-dioxan-2-yl]phenol? |
| A: Molecular weight of 2-[5,5-Dimethyl-4-(1-methylethyl)-1,3-dioxan-2-yl]phenol is 250.33. |
| Q: What is the CAS number of 2-[5,5-Dimethyl-4-(1-methylethyl)-1,3-dioxan-2-yl]phenol? |
| A: CAS number of 2-[5,5-Dimethyl-4-(1-methylethyl)-1,3-dioxan-2-yl]phenol is 61683-82-7. |
| Q: What is the molecular formula of 2-[5,5-Dimethyl-4-(1-methylethyl)-1,3-dioxan-2-yl]phenol? |
| A: Molecular formula of 2-[5,5-Dimethyl-4-(1-methylethyl)-1,3-dioxan-2-yl]phenol is C15H22O3. |
| Q: What is the English name of 2-[5,5-Dimethyl-4-(1-methylethyl)-1,3-dioxan-2-yl]phenol? |
| A: The English name of 2-[5,5-Dimethyl-4-(1-methylethyl)-1,3-dioxan-2-yl]phenol is 2-[5,5-Dimethyl-4-(1-methylethyl)-1,3-dioxan-2-yl]phenol. |
| Q: What is the Chinese name of 61683-82-7? |
| A: Chinese name of 61683-82-7 is 61683-82-7. |
| Q: What is the SMILES notation of 2-[5,5-Dimethyl-4-(1-methylethyl)-1,3-dioxan-2-yl]phenol? |
| A: SMILES notation of 2-[5,5-Dimethyl-4-(1-methylethyl)-1,3-dioxan-2-yl]phenol is CC(C)C1OC(c2ccccc2O)OCC1(C)C. |