tris(trimethylsilyl) propane-1,1,2-tricarboxylate structure
|
Common Name | tris(trimethylsilyl) propane-1,1,2-tricarboxylate | ||
|---|---|---|---|---|
| CAS Number | 61713-71-1 | Molecular Weight | 392.66700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H32O6Si3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | tris(trimethylsilyl) propane-1,1,2-tricarboxylate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H32O6Si3 |
|---|---|
| Molecular Weight | 392.66700 |
| Exact Mass | 392.15100 |
| PSA | 78.90000 |
| LogP | 3.37300 |
| InChIKey | QPUCMIJGVZQFHV-UHFFFAOYSA-N |
| SMILES | CC(C(=O)O[Si](C)(C)C)C(C(=O)O[Si](C)(C)C)C(=O)O[Si](C)(C)C |
|
~%
tris(trimethyls... CAS#:61713-71-1 |
| Literature: Pichat; Beaucourt; Krausz; Moulineau Journal of Labelled Compounds and Radiopharmaceuticals, 1976 , vol. 12, # 3 p. 347 - 355 |
|
~%
tris(trimethyls... CAS#:61713-71-1 |
| Literature: Pichat; Beaucourt; Krausz; Moulineau Journal of Labelled Compounds and Radiopharmaceuticals, 1976 , vol. 12, # 3 p. 347 - 355 |
| 1,1,2-Propanetricarboxylic acid,tris(trimethylsilyl) ester |
| Tris(trimethylsilyl) 1,1,2-propanetricarboxylate |
| 2-Carboxy-3-methyl-succinate,tris(trimethylsilyl) |