HT-0712 structure
|
Common Name | HT-0712 | ||
|---|---|---|---|---|
| CAS Number | 617720-02-2 | Molecular Weight | 393.518 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 583.1±50.0 °C at 760 mmHg | |
| Molecular Formula | C25H31NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 306.4±30.1 °C | |
Use of HT-0712HT-0712 (IPL-455903) is a novel potent, selective PDE4 inhibitor with IC50 of 0.15 uM for PDE4D3, without effect on PDE1B, PDE3A, and PDE10A. |
| Name | HT-0712 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 583.1±50.0 °C at 760 mmHg |
| Molecular Formula | C25H31NO3 |
| Molecular Weight | 393.518 |
| Flash Point | 306.4±30.1 °C |
| Exact Mass | 393.230408 |
| LogP | 4.45 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
| Index of Refraction | 1.569 |
| InChIKey | ABEJDMOBAFLQNJ-NHCUHLMSSA-N |
| SMILES | COc1ccc(C2CNC(=O)C(Cc3cccc(C)c3)C2)cc1OC1CCCC1 |
| HT-0712 |
| 2O43FXG9IG |
| 2-Piperidinone, 5-[3-(cyclopentyloxy)-4-methoxyphenyl]-3-[(3-methylphenyl)methyl]-, (3S,5S)- |
| (3S,5S)-5-[3-(Cyclopentyloxy)-4-methoxyphenyl]-3-(3-methylbenzyl)-2-piperidinone |