2',5-DICHLORO-2-HYDROXYBENZOPHENONE structure
|
Common Name | 2',5-DICHLORO-2-HYDROXYBENZOPHENONE | ||
|---|---|---|---|---|
| CAS Number | 61785-35-1 | Molecular Weight | 267.10700 | |
| Density | 1.406 g/cm3 | Boiling Point | 388.9ºCat 760 mmHg | |
| Molecular Formula | C13H8Cl2O2 | Melting Point | 107-110ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 189ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | (5-chloro-2-hydroxyphenyl)-(2-chlorophenyl)methanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.406 g/cm3 |
|---|---|
| Boiling Point | 388.9ºCat 760 mmHg |
| Melting Point | 107-110ºC(lit.) |
| Molecular Formula | C13H8Cl2O2 |
| Molecular Weight | 267.10700 |
| Flash Point | 189ºC |
| Exact Mass | 265.99000 |
| PSA | 37.30000 |
| LogP | 3.93000 |
| Index of Refraction | 1.631 |
| InChIKey | OSXVZDOVYCTYCW-UHFFFAOYSA-N |
| SMILES | O=C(c1cc(Cl)ccc1O)c1ccccc1Cl |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2914700090 |
|
~%
2',5-DICHLORO-2... CAS#:61785-35-1 |
| Literature: US2419553 , ; |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| MFCD02682994 |
| 5,2'-dichloro-2-hydroxy-benzophenone |
| EINECS 262-965-6 |
| 5,2'-Dichlor-2-hydroxy-benzophenon |
| 5-chloro-2-hydroxyphenyl 2-chlorophenyl ketone |
| 2',5-Dichloro-2-hydroxybenzophenone |