2-(4-formylphenyl)-6-(hydroxymethyl)pyridine structure
|
Common Name | 2-(4-formylphenyl)-6-(hydroxymethyl)pyridine | ||
|---|---|---|---|---|
| CAS Number | 618092-18-5 | Molecular Weight | 213.23200 | |
| Density | 1.229g/cm3 | Boiling Point | 399.4ºC at 760 mmHg | |
| Molecular Formula | C13H11NO2 | Melting Point | 75-79ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 195.4ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 4-[6-(hydroxymethyl)pyridin-2-yl]benzaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.229g/cm3 |
|---|---|
| Boiling Point | 399.4ºC at 760 mmHg |
| Melting Point | 75-79ºC(lit.) |
| Molecular Formula | C13H11NO2 |
| Molecular Weight | 213.23200 |
| Flash Point | 195.4ºC |
| Exact Mass | 213.07900 |
| PSA | 50.19000 |
| LogP | 2.05340 |
| Index of Refraction | 1.635 |
| InChIKey | RZHVETZHBRUIJF-UHFFFAOYSA-N |
| SMILES | O=Cc1ccc(-c2cccc(CO)n2)cc1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2933399090 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-(2-METHYL-4-NITRO-1H-IMIDAZOL-1-YL)ETHYLBENZOATE,CRM STANDARD |
| 2-(4-Formylphenyl)-6-(hydroxymethyl)pyridine |