(3,5-bis(trifluoromethyl)phenylethynyl)& structure
|
Common Name | (3,5-bis(trifluoromethyl)phenylethynyl)& | ||
|---|---|---|---|---|
| CAS Number | 618092-28-7 | Molecular Weight | 310.31000 | |
| Density | 1.21g/cm3 | Boiling Point | 225.6ºC at 760 mmHg | |
| Molecular Formula | C13H12F6Si | Melting Point | 43-47ºC(lit.) | |
| MSDS | USA | Flash Point | 85ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2-[3,5-bis(trifluoromethyl)phenyl]ethynyl-trimethylsilane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.21g/cm3 |
|---|---|
| Boiling Point | 225.6ºC at 760 mmHg |
| Melting Point | 43-47ºC(lit.) |
| Molecular Formula | C13H12F6Si |
| Molecular Weight | 310.31000 |
| Flash Point | 85ºC |
| Exact Mass | 310.06100 |
| LogP | 4.95310 |
| Index of Refraction | 1.436 |
| InChIKey | SKOOLTNOOKPCAJ-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)C#Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
|
~83%
(3,5-bis(triflu... CAS#:618092-28-7 |
| Literature: Wilson, James N.; Josowicz, Mira; Wang, Yiqing; Bunz, Uwe H. F. Chemical Communications, 2003 , # 24 p. 2962 - 2963 |
|
~73%
(3,5-bis(triflu... CAS#:618092-28-7 |
| Literature: Gallego, Daniel; Brueck, Andreas; Irran, Elisabeth; Meier, Florian; Kaupp, Martin; Driess, Matthias; Hartwig, John F. Journal of the American Chemical Society, 2013 , vol. 135, # 41 p. 15617 - 15626 |
| 1-trimethylsilyl-2-(3,5-bistrifluoromethylphenyl)acetylene |
| 3,5-bis(trifluoromethyl)phenylethynyltrimethylsilane |
| (3,5-Bis(trifluoromethyl)phenyl)(trimethylsilyl)acetylene |