N-(2,5-dimethoxyphenyl)-4-iodobenzamide structure
|
Common Name | N-(2,5-dimethoxyphenyl)-4-iodobenzamide | ||
|---|---|---|---|---|
| CAS Number | 6182-83-8 | Molecular Weight | 383.18100 | |
| Density | 1.607g/cm3 | Boiling Point | 395.7ºC at 760 mmHg | |
| Molecular Formula | C15H14INO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 193.1ºC | |
| Name | N-(2,5-dimethoxyphenyl)-4-iodobenzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.607g/cm3 |
|---|---|
| Boiling Point | 395.7ºC at 760 mmHg |
| Molecular Formula | C15H14INO3 |
| Molecular Weight | 383.18100 |
| Flash Point | 193.1ºC |
| Exact Mass | 383.00200 |
| PSA | 47.56000 |
| LogP | 3.63370 |
| Index of Refraction | 1.651 |
| InChIKey | LEYUQYRAITZCRM-UHFFFAOYSA-N |
| SMILES | COc1ccc(OC)c(NC(=O)c2ccc(I)cc2)c1 |
|
~%
N-(2,5-dimethox... CAS#:6182-83-8 |
| Literature: Oya; Matsumoto; Takashina; Iwao; Funae Chemical and Pharmaceutical Bulletin, 1981 , vol. 29, # 1 p. 63 - 70 |
| n-(2,5-dimethoxyphenyl)-4-iodo-benzamide |