cis-Pinonic acid structure
|
Common Name | cis-Pinonic acid | ||
|---|---|---|---|---|
| CAS Number | 61826-55-9 | Molecular Weight | 184.23200 | |
| Density | 1.0655 (rough estimate) | Boiling Point | 305.2ºC at 760 mmHg | |
| Molecular Formula | C10H16O3 | Melting Point | 104-107ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 152.6ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | pinonic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0655 (rough estimate) |
|---|---|
| Boiling Point | 305.2ºC at 760 mmHg |
| Melting Point | 104-107ºC(lit.) |
| Molecular Formula | C10H16O3 |
| Molecular Weight | 184.23200 |
| Flash Point | 152.6ºC |
| Exact Mass | 184.11000 |
| PSA | 54.37000 |
| LogP | 1.71240 |
| Index of Refraction | 1.5230 (estimate) |
| InChIKey | SIZDUQQDBXJXLQ-SFYZADRCSA-N |
| SMILES | CC(=O)C1CC(CC(=O)O)C1(C)C |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2918300090 |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|
Heterogeneous Kinetics of cis-Pinonic Acid with Hydroxyl Radical under Different Environmental Conditions.
J. Phys. Chem. A 119 , 6583-93, (2015) To understand the atmospheric fate of secondary organic aerosol (SOA), heterogeneous degradation behaviors of a specific tracer derived from α-pinene-cis-pinonic acid (CPA), initiated by hydroxyl radi... |
|
|
Fragmentation vs. functionalization: chemical aging and organic aerosol formation. Chacon-Madrid HJ and Donahue NM.
Atmos. Chem. Phys. 11(20) , 10553-10563, (2011)
|
| cis-3-acetyl-2,2-dimethyl-cyclobutaneacetic acid |
| MFCD00001327 |