6-[4-(dimethylamino)phenyl]-1,3,5-triazinane-2,4-dione structure
|
Common Name | 6-[4-(dimethylamino)phenyl]-1,3,5-triazinane-2,4-dione | ||
|---|---|---|---|---|
| CAS Number | 61851-93-2 | Molecular Weight | 234.25400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H14N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-[4-(dimethylamino)phenyl]-1,3,5-triazinane-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H14N4O2 |
|---|---|
| Molecular Weight | 234.25400 |
| Exact Mass | 234.11200 |
| PSA | 80.45000 |
| LogP | 0.38240 |
| InChIKey | FNEOAVURACWUFP-UHFFFAOYSA-N |
| SMILES | CN(C)c1ccc(C2NC(=O)NC(=O)N2)cc1 |
|
~21%
6-[4-(dimethyla... CAS#:61851-93-2 |
| Literature: Egorov, Ilya N.; Rusinov, Vladimir L.; Chupakhin, Oleg N. Tetrahedron Letters, 2010 , vol. 51, # 13 p. 1717 - 1718 |
|
~%
6-[4-(dimethyla... CAS#:61851-93-2 |
| Literature: Das-Gupta Journal of the Indian Chemical Society, 1933 , vol. 10, p. 111,114 |
| 6-(4-dimethylaminophenyl)-[1,3,5]triazinan-2,4-dione |
| 6-(4-Dimethylamino-phenyl)-dihydro-[1,3,5]triazin-2,4-dion |
| 6-(4-dimethylamino-phenyl)-[1,3,5]triazinane-2,4-dione |
| 1,3,5-Triazine-2,4(1H,3H)-dione,6-[4-(dimethylamino)phenyl]dihydro |
| 6-(4-dimethylamino-phenyl)-dihydro-[1,3,5]triazine-2,4-dione |