2-chloro-5-nitrobenzenesulphinic acid structure
|
Common Name | 2-chloro-5-nitrobenzenesulphinic acid | ||
|---|---|---|---|---|
| CAS Number | 61886-18-8 | Molecular Weight | 221.61800 | |
| Density | 1.82g/cm3 | Boiling Point | 461.8ºC at 760 mmHg | |
| Molecular Formula | C6H4ClNO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 233.1ºC | |
| Name | 2-chloro-5-nitrobenzenesulfinic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.82g/cm3 |
|---|---|
| Boiling Point | 461.8ºC at 760 mmHg |
| Molecular Formula | C6H4ClNO4S |
| Molecular Weight | 221.61800 |
| Flash Point | 233.1ºC |
| Exact Mass | 220.95500 |
| PSA | 102.33000 |
| LogP | 3.21770 |
| Index of Refraction | 1.722 |
| InChIKey | BATQLIHIWSGZNZ-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(Cl)c(S(=O)O)c1 |
| HS Code | 2930909090 |
|---|
|
~%
2-chloro-5-nitr... CAS#:61886-18-8 |
| Literature: Krishna Journal of the Chemical Society, 1923 , vol. 123, p. 157,2785,2788 |
|
~%
2-chloro-5-nitr... CAS#:61886-18-8 |
| Literature: Claasz Justus Liebigs Annalen der Chemie, 1911 , vol. 380, p. 312 |
| HS Code | 2930909090 |
|---|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-chloro-5-nitrobenzenesulphinic acid |
| 2-Chlor-5-nitro-benzolsulfinsaeure |
| EINECS 263-283-1 |
| 2-chloro-5-nitrobenzene sulfinic acid |