2-Chloro-5-nitrobenzenesulfonic acid structure
|
Common Name | 2-Chloro-5-nitrobenzenesulfonic acid | ||
|---|---|---|---|---|
| CAS Number | 96-73-1 | Molecular Weight | 237.618 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C6H4ClNO5S | Melting Point | >300ºC | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-chloro-5-nitrobenzenesulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Melting Point | >300ºC |
| Molecular Formula | C6H4ClNO5S |
| Molecular Weight | 237.618 |
| Exact Mass | 236.949875 |
| PSA | 108.57000 |
| LogP | 1.10 |
| Index of Refraction | 1.623 |
| InChIKey | GNTARUIZNIWBCN-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(Cl)c(S(=O)(=O)O)c1 |
| Storage condition | Refrigerator |
| HS Code | 2904909090 |
|---|
|
~98%
2-Chloro-5-nitr... CAS#:96-73-1 |
| Literature: Endyus'kin, V. P.; Lisitsyn, V. N.; Filippov, V. M.; Endyus'kin, P. N. J. Appl. Chem. USSR (Engl. Transl.), 1990 , vol. 63, # 7.2 p. 1568 - 1571,1442 - 1445 |
|
~%
2-Chloro-5-nitr... CAS#:96-73-1 |
| Literature: US5451666 A1, ; |
|
~%
2-Chloro-5-nitr... CAS#:96-73-1 |
| Literature: Chemische Berichte, , vol. 24, p. 3188 Chemische Berichte, , vol. 42, p. 1077 Justus Liebigs Annalen der Chemie, , vol. 265, p. 88 |
| Precursor 4 | |
|---|---|
| DownStream 10 | |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 2-Chloro-5-nitrobenzenesulfonic acid |
| 4-nitrochloro benzene-2-sulphonic acid |
| 6-chloro-3-nitrobenzenesulfonic acid |
| 4-chloro-3-sulphonitrobenzene |
| 3-Sulfo-4-chloronitrobenzene |
| MFCD00065336 |
| 2-chloro-5-nitro-benzenesulfonic acid |
| EINECS 202-528-9 |
| Benzenesulfonic acid,2-chloro-5-nitro |
| Benzenesulfonic acid, 2-chloro-5-nitro- |
| 5-nitro-2-chlorobenzenesulfonic acid |