4'-Chloro-5-methoxy-3-biphenylcarboxylic acid
Modify Date: 2025-09-30 15:49:02
4'-Chloro-5-methoxy-3-biphenylcarboxylic acid structure
|
Common Name | 4'-Chloro-5-methoxy-3-biphenylcarboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 61888-74-2 | Molecular Weight | 262.68800 | |
| Density | 1.292g/cm3 | Boiling Point | 441.6ºC at 760 mmHg | |
| Molecular Formula | C14H11ClO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 220.9ºC | |
| Name | 3-(4-chlorophenyl)-5-methoxybenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.292g/cm3 |
|---|---|
| Boiling Point | 441.6ºC at 760 mmHg |
| Molecular Formula | C14H11ClO3 |
| Molecular Weight | 262.68800 |
| Flash Point | 220.9ºC |
| Exact Mass | 262.04000 |
| PSA | 46.53000 |
| LogP | 3.71380 |
| Index of Refraction | 1.598 |
| InChIKey | CQECLZXFANKLPX-UHFFFAOYSA-N |
| SMILES | COc1cc(C(=O)O)cc(-c2ccc(Cl)cc2)c1 |
| HS Code | 2922299090 |
|---|
|
~%
4'-Chloro-5-met... CAS#:61888-74-2 |
| Literature: Tamura,Y. et al. Journal of Medicinal Chemistry, 1977 , vol. 20, p. 709 - 714 |
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4'-Chloro-5-methoxy-3-biphenylcarboxylic acid |
| 3-BIPHENYLCARBOXYLIC ACID,4'-CHLORO-5-METHOXY |
| [1,1'-Biphenyl]-3-carboxylicacid,4'-chloro-5-methoxy |
| 4'-Chlor-5-methoxy-3-biphenylylcarbonsaeure |