4-[2,6-dichloro-4-(trifluoromethyl)phenoxy]aniline structure
|
Common Name | 4-[2,6-dichloro-4-(trifluoromethyl)phenoxy]aniline | ||
|---|---|---|---|---|
| CAS Number | 61946-83-6 | Molecular Weight | 322.11000 | |
| Density | 1.466g/cm3 | Boiling Point | 329ºC at 760 mmHg | |
| Molecular Formula | C13H8Cl2F3NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 152.8ºC | |
| Name | 4-[2,6-dichloro-4-(trifluoromethyl)phenoxy]aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.466g/cm3 |
|---|---|
| Boiling Point | 329ºC at 760 mmHg |
| Molecular Formula | C13H8Cl2F3NO |
| Molecular Weight | 322.11000 |
| Flash Point | 152.8ºC |
| Exact Mass | 320.99400 |
| PSA | 35.25000 |
| LogP | 5.96790 |
| Index of Refraction | 1.566 |
| InChIKey | NGLXJSJOFZXMFB-UHFFFAOYSA-N |
| SMILES | Nc1ccc(Oc2c(Cl)cc(C(F)(F)F)cc2Cl)cc1 |
| Risk Phrases | 36/37/38 |
|---|---|
| Safety Phrases | 26-36/37/39 |
| HS Code | 2922299090 |
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2,6-dichloro-4'-amino-4-trifluoromethyl-diphenyl-ether |