2-amino-3,4-diethoxybenzoic acid structure
|
Common Name | 2-amino-3,4-diethoxybenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 61948-72-9 | Molecular Weight | 225.24100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H15NO4 | Melting Point | N/A | |
| MSDS | USA | Flash Point | N/A | |
| Name | 2-amino-3,4-diethoxybenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H15NO4 |
|---|---|
| Molecular Weight | 225.24100 |
| Exact Mass | 225.10000 |
| PSA | 81.78000 |
| LogP | 2.34560 |
| InChIKey | RIYLVSKCHUEVJE-UHFFFAOYSA-N |
| SMILES | CCOc1ccc(C(=O)O)c(N)c1OCC |
| HS Code | 2922509090 |
|---|
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3,4-Diaethoxyanthranilsaeure |