1H-Imidazole-5-carbonylchloride,1-methyl-4-nitro-(9CI) structure
|
Common Name | 1H-Imidazole-5-carbonylchloride,1-methyl-4-nitro-(9CI) | ||
|---|---|---|---|---|
| CAS Number | 61982-14-7 | Molecular Weight | 189.55700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C5H4ClN3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-methyl-5-nitroimidazole-4-carbonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C5H4ClN3O3 |
|---|---|
| Molecular Weight | 189.55700 |
| Exact Mass | 188.99400 |
| PSA | 80.71000 |
| LogP | 1.23050 |
| InChIKey | ICFIZGHDNGGJLG-UHFFFAOYSA-N |
| SMILES | Cn1cnc([N+](=O)[O-])c1C(=O)Cl |
| HS Code | 2933290090 |
|---|
|
~%
1H-Imidazole-5-... CAS#:61982-14-7 |
| Literature: Mann; Porter Journal of the Chemical Society, 1945 , p. 751,757 |
|
~%
1H-Imidazole-5-... CAS#:61982-14-7 |
| Literature: Kiselyov, Alexander S.; Piatnitski, Evgueni L.; Samet, Alexander V.; Kisliy, Victor P.; Semenov, Victor V. Bioorganic and Medicinal Chemistry Letters, 2007 , vol. 17, # 5 p. 1369 - 1375 |
| HS Code | 2933290090 |
|---|---|
| Summary | 2933290090. other compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-Methyl-5-nitro-3H-imidazol-4-carbonylchlorid |
| 1-methyl-4-nitroimidazole-5-carboxylic acid chloride |
| 1-methyl-4-nitroimidazolyl-5-carboxylic acid chloroanhydride |
| 1-methyl-4-nitro-1H-imidazole-5-carbonyl chloride |
| 3-methyl-5-nitro-3H-imidazole-4-carbonyl chloride |