1H-Imidazole-5-carboxylicacid, 1-methyl-4-nitro- structure
|
Common Name | 1H-Imidazole-5-carboxylicacid, 1-methyl-4-nitro- | ||
|---|---|---|---|---|
| CAS Number | 54828-05-6 | Molecular Weight | 171.11100 | |
| Density | 1.72g/cm3 | Boiling Point | 488.5ºC at 760 mmHg | |
| Molecular Formula | C5H5N3O4 | Melting Point | 163-164ºC | |
| MSDS | N/A | Flash Point | 249.2ºC | |
| Name | 3-methyl-5-nitroimidazole-4-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.72g/cm3 |
|---|---|
| Boiling Point | 488.5ºC at 760 mmHg |
| Melting Point | 163-164ºC |
| Molecular Formula | C5H5N3O4 |
| Molecular Weight | 171.11100 |
| Flash Point | 249.2ºC |
| Exact Mass | 171.02800 |
| PSA | 100.94000 |
| LogP | 0.54970 |
| Index of Refraction | 1.675 |
| InChIKey | XYGGCGCFZDEPOI-UHFFFAOYSA-N |
| SMILES | Cn1cnc([N+](=O)[O-])c1C(=O)O |
| HS Code | 2933290090 |
|---|
|
~92%
1H-Imidazole-5-... CAS#:54828-05-6 |
| Literature: Hosmane, Ramachandra S.; Bhan, Anila; Rauser, Michael E. Heterocycles, 1986 , vol. 24, # 10 p. 2743 - 2748 |
|
~%
1H-Imidazole-5-... CAS#:54828-05-6 |
| Literature: Journal of the Chemical Society, , p. 232,233 |
|
~%
1H-Imidazole-5-... CAS#:54828-05-6 |
| Literature: Chemische Berichte, , vol. 66, p. 1017 |
| Precursor 3 | |
|---|---|
| DownStream 9 | |
| HS Code | 2933290090 |
|---|---|
| Summary | 2933290090. other compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-methyl-4-nitroimidazole-5-carboxylic acid |
| 1-Methyl-4-nitro-1H-imidazole-5-carboxylic acid |
| 1h-imidazole-5-carboxylic acid,1-methyl-4-nitro |
| 3-methyl-5-nitro-3H-imidazole-4-carboxylic acid |
| 3-Methyl-5-nitro-3H-imidazol-4-carbonsaeure |