Androst-4-en-3-one,7,17-dihydroxy-, (7a,17b)
Androst-4-en-3-one,7,17-dihydroxy-, (7a,17b) structure
|
Common Name | Androst-4-en-3-one,7,17-dihydroxy-, (7a,17b) | ||
|---|---|---|---|---|
| CAS Number | 62-83-9 | Molecular Weight | 304.42400 | |
| Density | 1.19g/cm3 | Boiling Point | 478ºC at 760 mmHg | |
| Molecular Formula | C19H28O3 | Melting Point | 218-220ºC | |
| MSDS | N/A | Flash Point | 257ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 7α -hydroxytestosterone |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.19g/cm3 |
|---|---|
| Boiling Point | 478ºC at 760 mmHg |
| Melting Point | 218-220ºC |
| Molecular Formula | C19H28O3 |
| Molecular Weight | 304.42400 |
| Flash Point | 257ºC |
| Exact Mass | 304.20400 |
| PSA | 57.53000 |
| LogP | 2.85000 |
| Index of Refraction | 1.578 |
| InChIKey | RNCGWYKXAJCOLD-JUKXBMAYSA-N |
| SMILES | CC12CCC(=O)C=C1CC(O)C1C2CCC2(C)C(O)CCC12 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | Xn |
|---|---|
| Risk Phrases | 61-40 |
| Safety Phrases | 53-22-36/37/39 |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| (7R,8R,9S,10R,13S,14R,17S)-7,17-dihydroxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
| 7alpha -hydroxytestosterone |
| 7-hydroxytestosterone |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 7α -hydroxytestosterone? |
| A: Molecular weight of 7α -hydroxytestosterone is 304.42400. |
| Q: What is the polar surface area (PSA) of 7α -hydroxytestosterone? |
| A: Polar surface area (PSA) of 7α -hydroxytestosterone is 57.53000. |
| Q: What is the English name of 7α -hydroxytestosterone? |
| A: The English name of 7α -hydroxytestosterone is 7α -hydroxytestosterone. |
| Q: What English synonyms does 7α -hydroxytestosterone have? |
| A: English synonyms of 7α -hydroxytestosterone: (7R,8R,9S,10R,13S,14R,17S)-7,17-dihydroxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one, 7alpha -hydroxytestosterone, 7-hydroxytestosterone. |
| Q: What is the CAS number of 7α -hydroxytestosterone? |
| A: CAS number of 7α -hydroxytestosterone is 62-83-9. |
| Q: What is the SMILES notation of 7α -hydroxytestosterone? |
| A: SMILES notation of 7α -hydroxytestosterone is CC12CCC(=O)C=C1CC(O)C1C2CCC2(C)C(O)CCC12. |
| Q: What is the boiling point of 7α -hydroxytestosterone? |
| A: Boiling point of 7α -hydroxytestosterone is 478ºC at 760 mmHg. |
| Q: What is the molecular formula of 7α -hydroxytestosterone? |
| A: Molecular formula of 7α -hydroxytestosterone is C19H28O3. |
| Q: What is the melting point of 7α -hydroxytestosterone? |
| A: Melting point of 7α -hydroxytestosterone is 218-220ºC. |
| Q: What is the Chinese name of 62-83-9? |
| A: Chinese name of 62-83-9 is 62-83-9. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |