Benzoic acid,4-(phenylmethyl) structure
|
Common Name | Benzoic acid,4-(phenylmethyl) | ||
|---|---|---|---|---|
| CAS Number | 620-86-0 | Molecular Weight | 212.24400 | |
| Density | 1.17g/cm3 | Boiling Point | 372.4ºC at 760 mmHg | |
| Molecular Formula | C14H12O2 | Melting Point | 162-164ºC | |
| MSDS | N/A | Flash Point | 172.1ºC | |
| Name | Diphenylmethane-4-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.17g/cm3 |
|---|---|
| Boiling Point | 372.4ºC at 760 mmHg |
| Melting Point | 162-164ºC |
| Molecular Formula | C14H12O2 |
| Molecular Weight | 212.24400 |
| Flash Point | 172.1ºC |
| Exact Mass | 212.08400 |
| PSA | 37.30000 |
| LogP | 2.97560 |
| Index of Refraction | 1.605 |
| InChIKey | FPHVRPCVNPHPBH-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(Cc2ccccc2)cc1 |
| Risk Phrases | R36/37/38 |
|---|---|
| Safety Phrases | 26-36/37/39 |
| HS Code | 2916399090 |
| Precursor 10 | |
|---|---|
| DownStream 5 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 4-benzylbenzoic acid |