2,4-Imidazolidinedione,1-acetyl-5-(5-chloro-2-thienyl)-5-methyl- structure
|
Common Name | 2,4-Imidazolidinedione,1-acetyl-5-(5-chloro-2-thienyl)-5-methyl- | ||
|---|---|---|---|---|
| CAS Number | 62032-05-7 | Molecular Weight | 272.70800 | |
| Density | 1.481g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H9ClN2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-acetyl-5-(5-chlorothiophen-2-yl)-5-methylimidazolidine-2,4-dione |
|---|
| Density | 1.481g/cm3 |
|---|---|
| Molecular Formula | C10H9ClN2O3S |
| Molecular Weight | 272.70800 |
| Exact Mass | 272.00200 |
| PSA | 94.72000 |
| LogP | 1.98170 |
| Index of Refraction | 1.594 |
| InChIKey | JSTGAIJMIWATCZ-UHFFFAOYSA-N |
| SMILES | CC(=O)N1C(=O)NC(=O)C1(C)c1ccc(Cl)s1 |
|
~%
2,4-Imidazolidi... CAS#:62032-05-7 |
| Literature: Rodgers,T.R. et al. Journal of Medicinal Chemistry, 1977 , vol. 20, p. 591 - 594 |
|
~%
2,4-Imidazolidi... CAS#:62032-05-7 |
| Literature: Rodgers,T.R. et al. Journal of Medicinal Chemistry, 1977 , vol. 20, p. 591 - 594 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |