Ethyl 3-(1-naphthyl)-3-oxopropanoate structure
|
Common Name | Ethyl 3-(1-naphthyl)-3-oxopropanoate | ||
|---|---|---|---|---|
| CAS Number | 62071-76-5 | Molecular Weight | 242.270 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 370.0±15.0 °C at 760 mmHg | |
| Molecular Formula | C15H14O3 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 163.4±20.4 °C | |
| Name | ethyl 3-naphthalen-1-yl-3-oxopropanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 370.0±15.0 °C at 760 mmHg |
| Molecular Formula | C15H14O3 |
| Molecular Weight | 242.270 |
| Flash Point | 163.4±20.4 °C |
| Exact Mass | 242.094299 |
| PSA | 43.37000 |
| LogP | 3.10 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.586 |
| InChIKey | JFWSFANXHXCJOY-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC(=O)c1cccc2ccccc12 |
| HS Code | 2918300090 |
|---|
|
~%
Ethyl 3-(1-naph... CAS#:62071-76-5 |
| Literature: Journal of the Chemical Society, , p. 39,44 |
|
~64%
Ethyl 3-(1-naph... CAS#:62071-76-5 |
| Literature: EASTMAN CHEMICAL COMPANY Patent: EP1192189 B1, 2004 ; |
|
~%
Ethyl 3-(1-naph... CAS#:62071-76-5 |
| Literature: Organometallics, , vol. 31, # 3 p. 966 - 975 |
|
~%
Ethyl 3-(1-naph... CAS#:62071-76-5 |
| Literature: Bulletin de la Societe Chimique de France, , vol. <5> 6, p. 533,543 |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 1-Naphthalenepropanoic acid, β-oxo-, ethyl ester |
| ethyl 3-(naphthalen-8-yl)-3-oxopropanoate |
| 3-naphthalen-1-yl-3-oxo-propionic acid ethyl ester |
| Ethyl 3-(1-naphthyl)-3-oxopropanoate |
| ethyl 1-naphthoylacetate |
| b-Oxo-1-naphthalenepropanoic acid ethyl ester |
| AC-7792 |
| 3-[1]naphthyl-3-oxo-propionic acid ethyl ester |
| MFCD03424836 |
| ethyl 3-(naphthalen-1-yl)-3-oxopropanoate |