trans-4-Aminoadamantan-1-ol hydrochloride structure
|
Common Name | trans-4-Aminoadamantan-1-ol hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 62075-23-4 | Molecular Weight | 203.709 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H18ClNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | trans-4-Aminoadamantan-1-ol hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H18ClNO |
|---|---|
| Molecular Weight | 203.709 |
| Exact Mass | 203.107697 |
| PSA | 46.25000 |
| LogP | 2.38700 |
| InChIKey | KWEPNQFVPHYHHO-ILQIGJEOSA-N |
| SMILES | Cl.NC1C2CC3CC1CC(O)(C3)C2 |
| Hazard Codes | Xn |
|---|---|
| HS Code | 2922199090 |
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| (1R,3S)-4-Amino-1-adamantanol hydrochloride (1:1) |
| (3S)-4-aminoadamantan-1-ol,hydrochloride |
| Tricyclo[3.3.1.1]decan-1-ol, 4-amino-, (1R,3S)-, hydrochloride (1:1) |
| (1R,3S)-4-Aminoadamantan-1-ol hydrochloride (1:1) |
| 4-Amino-1-adamantanol hydrochloride (1:1) |
| Tricyclo[3.3.1.1]decan-1-ol, 4-amino-, hydrochloride (1:1) |