ethyl 2-[(2-methylpropan-2-yl)oxymethyl]but-2-enoate
![ethyl 2-[(2-methylpropan-2-yl)oxymethyl]but-2-enoate Structure](https://image.chemsrc.com/caspic/133/62097-07-8.png)
ethyl 2-[(2-methylpropan-2-yl)oxymethyl]but-2-enoate structure
|
Common Name | ethyl 2-[(2-methylpropan-2-yl)oxymethyl]but-2-enoate | ||
|---|---|---|---|---|
| CAS Number | 62097-07-8 | Molecular Weight | 200.27500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H20O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: Ethyl 2-[(2-methylpropan-2-yl)oxymethyl]but-2-enoate, CAS: 62097-07-8, molecular formula: C11H20O3, molecular weight: 200.27500. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | ethyl 2-[(2-methylpropan-2-yl)oxymethyl]but-2-enoate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H20O3 |
|---|---|
| Molecular Weight | 200.27500 |
| Exact Mass | 200.14100 |
| PSA | 35.53000 |
| LogP | 2.31090 |
| InChIKey | NNICTKDTWPCXMP-UHFFFAOYSA-N |
| SMILES | CC=C(COC(C)(C)C)C(=O)OCC |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
ethyl 2-[(2-met... CAS#:62097-07-8 |
| Literature: Goldberg,O.; Dreiding,A.S. Helvetica Chimica Acta, 1976 , vol. 59, p. 1904 - 1910 |
|
~%
ethyl 2-[(2-met... CAS#:62097-07-8 |
| Literature: Goldberg,O.; Dreiding,A.S. Helvetica Chimica Acta, 1976 , vol. 59, p. 1904 - 1910 |
|
~%
ethyl 2-[(2-met... CAS#:62097-07-8 |
| Literature: Goldberg,O.; Dreiding,A.S. Helvetica Chimica Acta, 1976 , vol. 59, p. 1904 - 1910 |
|
~%
ethyl 2-[(2-met... CAS#:62097-07-8 |
| Literature: Goldberg,O.; Dreiding,A.S. Helvetica Chimica Acta, 1976 , vol. 59, p. 1904 - 1910 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2-Butenoic acid,2-[(1,1-dimethylethoxy)methyl]-,ethyl ester,(E) |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does ethyl 2-[(2-methylpropan-2-yl)oxymethyl]but-2-enoate have? |
| A: English synonyms of ethyl 2-[(2-methylpropan-2-yl)oxymethyl]but-2-enoate: 2-Butenoic acid,2-[(1,1-dimethylethoxy)methyl]-,ethyl ester,(E). |
| Q: What is the InChIKey of ethyl 2-[(2-methylpropan-2-yl)oxymethyl]but-2-enoate? |
| A: InChIKey of ethyl 2-[(2-methylpropan-2-yl)oxymethyl]but-2-enoate is NNICTKDTWPCXMP-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of ethyl 2-[(2-methylpropan-2-yl)oxymethyl]but-2-enoate? |
| A: SMILES notation of ethyl 2-[(2-methylpropan-2-yl)oxymethyl]but-2-enoate is CC=C(COC(C)(C)C)C(=O)OCC. |
| Q: What is the CAS number of ethyl 2-[(2-methylpropan-2-yl)oxymethyl]but-2-enoate? |
| A: CAS number of ethyl 2-[(2-methylpropan-2-yl)oxymethyl]but-2-enoate is 62097-07-8. |
| Q: What is the molecular formula of ethyl 2-[(2-methylpropan-2-yl)oxymethyl]but-2-enoate? |
| A: Molecular formula of ethyl 2-[(2-methylpropan-2-yl)oxymethyl]but-2-enoate is C11H20O3. |
| Q: What is the English name of ethyl 2-[(2-methylpropan-2-yl)oxymethyl]but-2-enoate? |
| A: The English name of ethyl 2-[(2-methylpropan-2-yl)oxymethyl]but-2-enoate is ethyl 2-[(2-methylpropan-2-yl)oxymethyl]but-2-enoate. |
| Q: What is the LogP of ethyl 2-[(2-methylpropan-2-yl)oxymethyl]but-2-enoate? |
| A: LogP of ethyl 2-[(2-methylpropan-2-yl)oxymethyl]but-2-enoate is 2.31090. |
| Q: What is the molecular weight of ethyl 2-[(2-methylpropan-2-yl)oxymethyl]but-2-enoate? |
| A: Molecular weight of ethyl 2-[(2-methylpropan-2-yl)oxymethyl]but-2-enoate is 200.27500. |
| Q: What is the Chinese name of 62097-07-8? |
| A: Chinese name of 62097-07-8 is 62097-07-8. |
| Q: What is the polar surface area (PSA) of ethyl 2-[(2-methylpropan-2-yl)oxymethyl]but-2-enoate? |
| A: Polar surface area (PSA) of ethyl 2-[(2-methylpropan-2-yl)oxymethyl]but-2-enoate is 35.53000. |