Carbonic acid,bis(4-methylphenyl) ester structure
|
Common Name | Carbonic acid,bis(4-methylphenyl) ester | ||
|---|---|---|---|---|
| CAS Number | 621-02-3 | Molecular Weight | 242.27000 | |
| Density | 1.145g/cm3 | Boiling Point | 343.8ºC at 760mmHg | |
| Molecular Formula | C15H14O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 126.8ºC | |
| Name | bis(4-methylphenyl) carbonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.145g/cm3 |
|---|---|
| Boiling Point | 343.8ºC at 760mmHg |
| Molecular Formula | C15H14O3 |
| Molecular Weight | 242.27000 |
| Flash Point | 126.8ºC |
| Exact Mass | 242.09400 |
| PSA | 35.53000 |
| LogP | 3.88120 |
| Index of Refraction | 1.564 |
| InChIKey | IZJIAOFBVVYSMA-UHFFFAOYSA-N |
| SMILES | Cc1ccc(OC(=O)Oc2ccc(C)cc2)cc1 |
| HS Code | 2920909090 |
|---|
| Precursor 8 | |
|---|---|
| DownStream 9 | |
| HS Code | 2920909090 |
|---|---|
| Summary | 2920909090 esters of other inorganic acids of non-metals (excluding esters of hydrogen halides) and their salts; their halogenated, sulphonated, nitrated or nitrosated derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| di-p-tolyl carbonate |
| Kohlensaeure-di-p-tolylester |
| Di-p-tolyl-carbonat |
| carbonic acid di-p-tolyl ester |
| di-p-cresyl carbonate |