3-Nitrophenetole structure
|
Common Name | 3-Nitrophenetole | ||
|---|---|---|---|---|
| CAS Number | 621-52-3 | Molecular Weight | 167.16200 | |
| Density | 1.178g/cm3 | Boiling Point | 270.7ºC at 760 mmHg | |
| Molecular Formula | C8H9NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 31ºC | |
Use of 3-Nitrophenetole3-Nitrophenetole is a biochemical. |
| Name | 1-Ethoxy-3-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.178g/cm3 |
|---|---|
| Boiling Point | 270.7ºC at 760 mmHg |
| Molecular Formula | C8H9NO3 |
| Molecular Weight | 167.16200 |
| Flash Point | 31ºC |
| Exact Mass | 167.05800 |
| PSA | 55.05000 |
| LogP | 2.51670 |
| Index of Refraction | 1.534 |
| InChIKey | LFOLBPDHVGDKGJ-UHFFFAOYSA-N |
| SMILES | CCOc1cccc([N+](=O)[O-])c1 |
| HS Code | 2909309090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 7 | |
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 1-ethoxy-3-nitrobenzene |
| EINECS 210-691-2 |