Carbonic dihydrazide,2,2'-bis(4-nitrophenyl) structure
|
Common Name | Carbonic dihydrazide,2,2'-bis(4-nitrophenyl) | ||
|---|---|---|---|---|
| CAS Number | 622-69-5 | Molecular Weight | 332.27200 | |
| Density | 1.573g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C13H12N6O5 | Melting Point | 361ºC | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,5-Bis(4-nitrophenyl)carbohydrazide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.573g/cm3 |
|---|---|
| Melting Point | 361ºC |
| Molecular Formula | C13H12N6O5 |
| Molecular Weight | 332.27200 |
| Exact Mass | 332.08700 |
| PSA | 156.83000 |
| LogP | 4.13040 |
| Index of Refraction | 1.742 |
| InChIKey | CEMQVKAEUMRRQJ-UHFFFAOYSA-N |
| SMILES | O=C(NNc1ccc([N+](=O)[O-])cc1)NNc1ccc([N+](=O)[O-])cc1 |
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | R36/37/38:Irritating to eyes, respiratory system and skin . |
| Safety Phrases | S26-S37/39 |
| WGK Germany | 3 |
|
~%
Carbonic dihydr... CAS#:622-69-5 |
| Literature: Mistry; Guha Journal of the Indian Chemical Society, 1930 , vol. 7, p. 794 Chem. Zentralbl., 1931 , vol. 102, # I p. 1438 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1,3-bis(4-nitroanilino)urea |