ethyl methyl 2,2,2-trichloroethyl phosphate structure
|
Common Name | ethyl methyl 2,2,2-trichloroethyl phosphate | ||
|---|---|---|---|---|
| CAS Number | 62217-77-0 | Molecular Weight | 271.46300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C5H10Cl3O4P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl methyl 2,2,2-trichloroethyl phosphate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C5H10Cl3O4P |
|---|---|
| Molecular Weight | 271.46300 |
| Exact Mass | 269.93800 |
| PSA | 54.57000 |
| LogP | 3.16420 |
| InChIKey | BUKJGNXIKLSVMZ-UHFFFAOYSA-N |
| SMILES | CCOP(=O)(OC)OCC(Cl)(Cl)Cl |
|
~%
ethyl methyl 2,... CAS#:62217-77-0 |
| Literature: Ogilvie,K.K. et al. Journal of the American Chemical Society, 1977 , vol. 99, p. 1277 - 1278 |
| phosphoric acid ethyl ester methyl ester 2,2,2-trichloro-ethyl ester |
| (Trichlorethyl)-ethyl-methylphosphat |
| Phosphoric acid,ethyl methyl 2,2,2-trichloroethyl ester |