4-Hydroxy-2,6,6-trimethyl-1-cyclohexenecarboxylic acid structure
|
Common Name | 4-Hydroxy-2,6,6-trimethyl-1-cyclohexenecarboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 62218-55-7 | Molecular Weight | 184.232 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 318.7±42.0 °C at 760 mmHg | |
| Molecular Formula | C10H16O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 160.8±24.4 °C | |
| Name | 4-Hydroxy-2,6,6-trimethyl-1-cyclohexenecarboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 318.7±42.0 °C at 760 mmHg |
| Molecular Formula | C10H16O3 |
| Molecular Weight | 184.232 |
| Flash Point | 160.8±24.4 °C |
| Exact Mass | 184.109940 |
| PSA | 57.53000 |
| LogP | 1.97 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.512 |
| InChIKey | VLNNCUQICIFEOF-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)O)C(C)(C)CC(O)C1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2918199090 |
| HS Code | 2918199090 |
|---|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 4-Hydroxy-2,6,6-trimethyl-1-cyclohexene-1-carboxylic acid |
| 1-Cyclohexene-1-carboxylic acid, 4-hydroxy-2,6,6-trimethyl- |