1,3-dimethyl-6-phenyl-1,3,5-triazine-2,4-dione structure
|
Common Name | 1,3-dimethyl-6-phenyl-1,3,5-triazine-2,4-dione | ||
|---|---|---|---|---|
| CAS Number | 62220-98-8 | Molecular Weight | 217.22400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H11N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,3-dimethyl-6-phenyl-1,3,5-triazine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H11N3O2 |
|---|---|
| Molecular Weight | 217.22400 |
| Exact Mass | 217.08500 |
| PSA | 56.89000 |
| LogP | 0.14600 |
| InChIKey | QEFQOQBGEBOWOJ-UHFFFAOYSA-N |
| SMILES | Cn1c(-c2ccccc2)nc(=O)n(C)c1=O |
|
~%
1,3-dimethyl-6-... CAS#:62220-98-8 |
| Literature: Bloch; Sobotka Journal of the American Chemical Society, 1938 , vol. 60, p. 1656 |
| 1,3,5-Triazine-2,4(1H,3H)-dione,1,3-dimethyl-6-phenyl |
| 1,3-Dimethyl-6-phenyl-1,2,3,4-tetrahydro-2,4-dioxo-1,3,5-triazin |
| 1,3-dimethyl-6-phenyl-1H-[1,3,5]triazine-2,4-dione |
| 1,3-dimethyl-6-phenyl-triazine-2,4-dione |
| 1,3-Dimethyl-6-phenyl-1H-[1,3,5]triazin-2,4-dion |