6-phenyl-1,3,5-triazine-2,4(1H,3H)-dione structure
|
Common Name | 6-phenyl-1,3,5-triazine-2,4(1H,3H)-dione | ||
|---|---|---|---|---|
| CAS Number | 7459-63-4 | Molecular Weight | 189.17100 | |
| Density | 1.46 g/cm3 | Boiling Point | 548.3ºC at 760 mmHg | |
| Molecular Formula | C9H7N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 285.4ºC | |
| Name | 6-phenyl-1H-1,3,5-triazine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.46 g/cm3 |
|---|---|
| Boiling Point | 548.3ºC at 760 mmHg |
| Molecular Formula | C9H7N3O2 |
| Molecular Weight | 189.17100 |
| Flash Point | 285.4ºC |
| Exact Mass | 189.05400 |
| PSA | 79.13000 |
| LogP | 0.94980 |
| Index of Refraction | 1.697 |
| InChIKey | KGKPZSCTAFFXBV-UHFFFAOYSA-N |
| SMILES | O=c1nc(-c2ccccc2)[nH]c(=O)[nH]1 |
| HS Code | 2933699090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 4 | |
| HS Code | 2933699090 |
|---|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
| 6-phenyl-1H-[1,3,5]triazine-2,4-dione |
| EINECS 231-236-4 |
| 6-PHENYL-1,3,5-TRIAZINE-2,4-DIOL |
| 6-phenyl-1,3,5-triazine-2,4-dione |
| 6-Phenyl-1H-[1,3,5]triazin-2,4-dion |
| 6-phenyl-1,3,5-triazine-2,4(1H,3H)-dione |