ethyl 5-tert-butylcyclohexene-1-carboxylate structure
|
Common Name | ethyl 5-tert-butylcyclohexene-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 62222-98-4 | Molecular Weight | 210.31300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H22O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 5-tert-butylcyclohexene-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H22O2 |
|---|---|
| Molecular Weight | 210.31300 |
| Exact Mass | 210.16200 |
| PSA | 26.30000 |
| LogP | 3.32210 |
| InChIKey | HYYZTWFLMUEIDC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CCCC(C(C)(C)C)C1 |
|
~%
ethyl 5-tert-bu... CAS#:62222-98-4 |
| Literature: Hapala,J.; Tichy,M. Collection of Czechoslovak Chemical Communications, 1976 , vol. 41, p. 2928 - 2941 |
|
~%
ethyl 5-tert-bu... CAS#:62222-98-4 |
| Literature: Hapala,J.; Tichy,M. Collection of Czechoslovak Chemical Communications, 1976 , vol. 41, p. 2928 - 2941 |
| 1-Cyclohexene-1-carboxylic acid,5-(1,1-dimethylethyl)-,ethyl ester |
| 5-tert-Butylcyclohex-1-enecarboxylic acid ethyl ester |
| 4-tert.-Butylcyclohex-1-encarbonsaeureethylester |