tert-butyl 4,5-dibromothiophene-2-carboxylate structure
|
Common Name | tert-butyl 4,5-dibromothiophene-2-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 62224-26-4 | Molecular Weight | 342.04800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H10Br2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | tert-butyl 4,5-dibromothiophene-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H10Br2O2S |
|---|---|
| Molecular Weight | 342.04800 |
| Exact Mass | 339.87700 |
| PSA | 54.54000 |
| LogP | 4.22840 |
| InChIKey | BTJZDXNGGWDHJG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)c1cc(Br)c(Br)s1 |
|
~%
tert-butyl 4,5-... CAS#:62224-26-4 |
| Literature: Muratake, Hideaki; Okabe, Kazuaki; Takahashi, Michiko; Tonegawa, Miyuki; Natsume, Mitsutaka Chemical and Pharmaceutical Bulletin, 1997 , vol. 45, # 5 p. 799 - 806 |
|
~%
tert-butyl 4,5-... CAS#:62224-26-4 |
| Literature: Muratake, Hideaki; Okabe, Kazuaki; Takahashi, Michiko; Tonegawa, Miyuki; Natsume, Mitsutaka Chemical and Pharmaceutical Bulletin, 1997 , vol. 45, # 5 p. 799 - 806 |
| 4,5-dibromo-thiophene-2-carboxylic acid tert-butyl ester |
| 2-Thiophenecarboxylic acid,4,5-dibromo-,1,1-dimethylethyl ester |
| 4,5-Dibromthiophen-2-carbonsaeure-t-butylester |
| tert-butyl 4,5-dibromo-2-thiophenecarboxylate |